C16H17NOS — CID 740549
[(3R)-3-phenylpiperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 740549) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is [(3R)-3-phenylpiperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3R)-3-phenylpiperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 740549 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [(3R)-3-phenylpiperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H17NOS/c18-16(15-9-5-11-19-15)17-10-4-8-14(12-17)13-6-2-1-3-7-13/h1-3,5-7,9,11,14H,4,8,10,12H2/t14-/m0/s1 |
| InChIKey | UYDXHDOMLSUUEF-AWEZNQCLSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |