C21H21N3O3S — CID 55556702
(4-pyrazol-1-ylphenyl)methyl 1-(thiophene-2-carbonyl)piperidine-3-carboxylate (PubChem CID 55556702) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 1-(thiophene-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55556702 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
| SMILES | O=C(OCc1ccc(-n2cccn2)cc1)C1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C21H21N3O3S/c25-20(19-5-2-13-28-19)23-11-1-4-17(14-23)21(26)27-15-16-6-8-18(9-7-16)24-12-3-10-22-24/h2-3,5-10,12-13,17H,1,4,11,14-15H2 |
| InChIKey | DQDYEJMJNRUXKW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |