C20H21N3O4S2 — CID 16566087
(4-pyrazol-1-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate (PubChem CID 16566087) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 16566087 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
| SMILES | O=C(OCc1ccc(-n2cccn2)cc1)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H21N3O4S2/c24-20(27-15-16-4-6-18(7-5-16)23-11-2-10-21-23)17-8-12-22(13-9-17)29(25,26)19-3-1-14-28-19/h1-7,10-11,14,17H,8-9,12-13,15H2 |
| InChIKey | MTKZCNZFHLHHBN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |