C17H18N2O2 — CID 60607313
(4-pyrazol-1-ylphenyl)methyl cyclohex-3-ene-1-carboxylate (PubChem CID 60607313) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl cyclohex-3-ene-1-carboxylate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 60607313 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCc1ccc(-n2cccn2)cc1)C1CC=CCC1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(15-5-2-1-3-6-15)21-13-14-7-9-16(10-8-14)19-12-4-11-18-19/h1-2,4,7-12,15H,3,5-6,13H2 |
| InChIKey | NRIOARBCHCRWCB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|