C19H19N3O3S — CID 167899744
(4-pyrazol-1-ylphenyl)methyl 2-(oxan-4-yl)-1,3-thiazole-5-carboxylate (PubChem CID 167899744) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 2-(oxan-4-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 2-(oxan-4-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 167899744 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 2-(oxan-4-yl)-1,3-thiazole-5-carboxylate |
| SMILES | O=C(OCc1ccc(-n2cccn2)cc1)c1cnc(C2CCOCC2)s1 |
| InChI | InChI=1S/C19H19N3O3S/c23-19(17-12-20-18(26-17)15-6-10-24-11-7-15)25-13-14-2-4-16(5-3-14)22-9-1-8-21-22/h1-5,8-9,12,15H,6-7,10-11,13H2 |
| InChIKey | QJSVGCHWRWNJKZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |