C21H23N3O4 — CID 55943579
(4-pyrazol-1-ylphenyl)methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55943579) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55943579 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCc1ccc(-n2cccn2)cc1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C21H23N3O4/c1-14(24-19(25)17-5-2-3-6-18(17)20(24)26)21(27)28-13-15-7-9-16(10-8-15)23-12-4-11-22-23/h4,7-12,14,17-18H,2-3,5-6,13H2,1H3/t14-,17?,18?/m0/s1 |
| InChIKey | LAPZTRCZVITKFZ-NNGSBXSVSA-N |
| XLogP | 2.48 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|