C19H20N2O5 — CID 55365853
1,3-benzoxazol-2-ylmethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55365853) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55365853 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCc1nc2ccccc2o1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H20N2O5/c1-11(21-17(22)12-6-2-3-7-13(12)18(21)23)19(24)25-10-16-20-14-8-4-5-9-15(14)26-16/h4-5,8-9,11-13H,2-3,6-7,10H2,1H3 |
| InChIKey | RRKIAWNZQWXBSE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|