C22H23NO4 — CID 8846939
naphthalen-1-ylmethyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 8846939) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is naphthalen-1-ylmethyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | naphthalen-1-ylmethyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8846939 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | naphthalen-1-ylmethyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | C[C@@H](C(=O)OCc1cccc2ccccc12)N1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C22H23NO4/c1-14(23-20(24)18-11-4-5-12-19(18)21(23)25)22(26)27-13-16-9-6-8-15-7-2-3-10-17(15)16/h2-3,6-10,14,18-19H,4-5,11-13H2,1H3/t14-,18-,19-/m0/s1 |
| InChIKey | WRXDCPASEXRQHJ-JVPBZIDWSA-N |
| XLogP | 3.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|