C23H26N2O5 — CID 8847117
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 8847117) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8847117 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)[C@H](C)N3C(=O)[C@H]4CCCC[C@@H]4C3=O)c[nH]c12 |
| InChI | InChI=1S/C23H26N2O5/c1-3-14-7-6-10-15-18(11-24-20(14)15)19(26)12-30-23(29)13(2)25-21(27)16-8-4-5-9-17(16)22(25)28/h6-7,10-11,13,16-17,24H,3-5,8-9,12H2,1-2H3/t13-,16-,17-/m0/s1 |
| InChIKey | DHVDROJNEXNYJG-JQFCIGGWSA-N |
| XLogP | 3.02 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|