C23H24ClNO3 — CID 7209268
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7209268) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7209268 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)[C@H](c3ccc(Cl)cc3)C(C)C)c[nH]c12 |
| InChI | InChI=1S/C23H24ClNO3/c1-4-15-6-5-7-18-19(12-25-22(15)18)20(26)13-28-23(27)21(14(2)3)16-8-10-17(24)11-9-16/h5-12,14,21,25H,4,13H2,1-3H3/t21-/m0/s1 |
| InChIKey | IOQDBNBXIQOHAG-NRFANRHFSA-N |
| XLogP | 5.55 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |