C22H22N2O4 — CID 51535248
(4-pyrazol-1-ylphenyl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate (PubChem CID 51535248) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 51535248 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(OCc1ccc(-n2cccn2)cc1)c1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H22N2O4/c25-22(18-6-10-20(11-7-18)27-16-21-3-1-14-26-21)28-15-17-4-8-19(9-5-17)24-13-2-12-23-24/h2,4-13,21H,1,3,14-16H2/t21-/m1/s1 |
| InChIKey | LVBAUZPPNGDWNV-OAQYLSRUSA-N |
| XLogP | 3.79 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |