C22H22ClN3O4S — CID 46514071
(4-pyrazol-1-ylphenyl)methyl 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 46514071) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 46514071 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C(OCc1ccc(-n2cccn2)cc1)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H22ClN3O4S/c23-19-6-10-21(11-7-19)31(28,29)25-13-1-3-18(15-25)22(27)30-16-17-4-8-20(9-5-17)26-14-2-12-24-26/h2,4-12,14,18H,1,3,13,15-16H2 |
| InChIKey | QIIJUHANSMLMCN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |