C19H29N3O2S — CID 134034140
[4-(2-methylpropyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone (PubChem CID 134034140) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is [4-(2-methylpropyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone.
| Compound Name | [4-(2-methylpropyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 134034140 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | [4-(2-methylpropyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone |
| SMILES | CC(C)CN1CCN(C(=O)C2CCCN(C(=O)c3cccs3)C2)CC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-15(2)13-20-8-10-21(11-9-20)18(23)16-5-3-7-22(14-16)19(24)17-6-4-12-25-17/h4,6,12,15-16H,3,5,7-11,13-14H2,1-2H3 |
| InChIKey | WSDCEPRFJOBIBO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |