C20H22N4O5S2 — CID 46465219
[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone (PubChem CID 46465219) has the molecular formula C20H22N4O5S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is [4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone.
| Compound Name | [4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 46465219 |
| Molecular Formula | C20H22N4O5S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | [4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1cccs1)N1CCCC(C(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])s3)CC2)C1 |
| InChI | InChI=1S/C20H22N4O5S2/c25-18(14-3-1-7-23(13-14)19(26)15-4-2-12-30-15)21-8-10-22(11-9-21)20(27)16-5-6-17(31-16)24(28)29/h2,4-6,12,14H,1,3,7-11,13H2 |
| InChIKey | AKMYGMMJEHSZBH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|