About 2-bromo-N-phenylacetamide;cyclopropane
2-bromo-N-phenylacetamide;cyclopropane (PubChem CID 174384645) has the molecular formula C11H14BrNO
and a molecular weight of 256.14 g/mol. Its IUPAC name is 2-bromo-N-phenylacetamide;cyclopropane.
Molecular Properties
| Compound Name | 2-bromo-N-phenylacetamide;cyclopropane |
| PubChem CID | 174384645 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-bromo-N-phenylacetamide;cyclopropane |
| SMILES | C1CC1.O=C(CBr)Nc1ccccc1 |
| InChI | InChI=1S/C8H8BrNO.C3H6/c9-6-8(11)10-7-4-2-1-3-5-7;1-2-3-1/h1-5H,6H2,(H,10,11);1-3H2 |
| InChIKey | QDOYZFLUIUKZHN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-phenylacetamide;cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-phenylacetamide;cyclopropane?
The IUPAC name of 2-bromo-N-phenylacetamide;cyclopropane (CID 174384645) is 2-bromo-N-phenylacetamide;cyclopropane.
What is the SMILES notation for 2-bromo-N-phenylacetamide;cyclopropane?
The canonical SMILES for 2-bromo-N-phenylacetamide;cyclopropane is C1CC1.O=C(CBr)Nc1ccccc1.
What is the InChIKey of 2-bromo-N-phenylacetamide;cyclopropane?
The InChIKey is QDOYZFLUIUKZHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO.C3H6/c9-6-8(11)10-7-4-2-1-3-5-7;1-2-3-1/h1-5H,6H2,(H,10,11);1-3H2.
What are the key properties of 2-bromo-N-phenylacetamide;cyclopropane?
2-bromo-N-phenylacetamide;cyclopropane has a molecular weight of 256.14 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-phenylacetamide;cyclopropane is sourced from PubChem (CID 174384645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).