C9H22N4 — CID 102263494
1-(dimethylamino)-2,3-di(propan-2-yl)guanidine (PubChem CID 102263494) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-(dimethylamino)-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-(dimethylamino)-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 102263494 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 1-(dimethylamino)-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\NC(C)C)NN(C)C |
| InChI | InChI=1S/C9H22N4/c1-7(2)10-9(11-8(3)4)12-13(5)6/h7-8H,1-6H3,(H2,10,11,12) |
| InChIKey | LJXQOHNXRTWTPF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|