About 2,3-di(propan-2-yl)-1,1-dipropylguanidine
2,3-di(propan-2-yl)-1,1-dipropylguanidine (PubChem CID 101420420) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-1,1-dipropylguanidine.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-1,1-dipropylguanidine |
| PubChem CID | 101420420 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 2,3-di(propan-2-yl)-1,1-dipropylguanidine |
| SMILES | CCCN(CCC)/C(=N\C(C)C)NC(C)C |
| InChI | InChI=1S/C13H29N3/c1-7-9-16(10-8-2)13(14-11(3)4)15-12(5)6/h11-12H,7-10H2,1-6H3,(H,14,15) |
| InChIKey | FRALUTKTQRVPNU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-di(propan-2-yl)-1,1-dipropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-1,1-dipropylguanidine?
The IUPAC name of 2,3-di(propan-2-yl)-1,1-dipropylguanidine (CID 101420420) is 2,3-di(propan-2-yl)-1,1-dipropylguanidine.
What is the SMILES notation for 2,3-di(propan-2-yl)-1,1-dipropylguanidine?
The canonical SMILES for 2,3-di(propan-2-yl)-1,1-dipropylguanidine is CCCN(CCC)/C(=N\C(C)C)NC(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-1,1-dipropylguanidine?
The InChIKey is FRALUTKTQRVPNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3/c1-7-9-16(10-8-2)13(14-11(3)4)15-12(5)6/h11-12H,7-10H2,1-6H3,(H,14,15).
What are the key properties of 2,3-di(propan-2-yl)-1,1-dipropylguanidine?
2,3-di(propan-2-yl)-1,1-dipropylguanidine has a molecular weight of 227.40 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-1,1-dipropylguanidine is sourced from PubChem (CID 101420420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).