C14H32N4 — CID 107871905
3-amino-1,1-bis(3-methylbutyl)-2-propan-2-ylguanidine (PubChem CID 107871905) has the molecular formula C14H32N4 and a molecular weight of 256.44 g/mol. Its IUPAC name is 3-amino-1,1-bis(3-methylbutyl)-2-propan-2-ylguanidine.
| Compound Name | 3-amino-1,1-bis(3-methylbutyl)-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 107871905 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 3-amino-1,1-bis(3-methylbutyl)-2-propan-2-ylguanidine |
| SMILES | CC(C)CCN(CCC(C)C)/C(=N\C(C)C)NN |
| InChI | InChI=1S/C14H32N4/c1-11(2)7-9-18(10-8-12(3)4)14(17-15)16-13(5)6/h11-13H,7-10,15H2,1-6H3,(H,16,17) |
| InChIKey | JNMBBQCOBUSRLV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|