About 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine
3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine (PubChem CID 104883546) has the molecular formula C9H22N4
and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine.
Molecular Properties
| Compound Name | 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine |
| PubChem CID | 104883546 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine |
| SMILES | CCN(/C(=N\C(C)C)NN)C(C)C |
| InChI | InChI=1S/C9H22N4/c1-6-13(8(4)5)9(12-10)11-7(2)3/h7-8H,6,10H2,1-5H3,(H,11,12) |
| InChIKey | QJNURCVKOQRZBF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine?
The IUPAC name of 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine (CID 104883546) is 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine.
What is the SMILES notation for 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine?
The canonical SMILES for 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine is CCN(/C(=N\C(C)C)NN)C(C)C.
What is the InChIKey of 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine?
The InChIKey is QJNURCVKOQRZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N4/c1-6-13(8(4)5)9(12-10)11-7(2)3/h7-8H,6,10H2,1-5H3,(H,11,12).
What are the key properties of 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine?
3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine has a molecular weight of 186.30 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-ethyl-1,2-di(propan-2-yl)guanidine is sourced from PubChem (CID 104883546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).