C11H26N4 — CID 104883501
3-amino-1-ethyl-1,2-bis(2-methylpropyl)guanidine (PubChem CID 104883501) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is 3-amino-1-ethyl-1,2-bis(2-methylpropyl)guanidine.
| Compound Name | 3-amino-1-ethyl-1,2-bis(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 104883501 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | 3-amino-1-ethyl-1,2-bis(2-methylpropyl)guanidine |
| SMILES | CCN(CC(C)C)/C(=N\CC(C)C)NN |
| InChI | InChI=1S/C11H26N4/c1-6-15(8-10(4)5)11(14-12)13-7-9(2)3/h9-10H,6-8,12H2,1-5H3,(H,13,14) |
| InChIKey | MCAQMFWUQQINGH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|