C7H18N4 — CID 104883395
3-amino-1,1-dimethyl-2-(2-methylpropyl)guanidine (PubChem CID 104883395) has the molecular formula C7H18N4 and a molecular weight of 158.25 g/mol. Its IUPAC name is 3-amino-1,1-dimethyl-2-(2-methylpropyl)guanidine.
| Compound Name | 3-amino-1,1-dimethyl-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 104883395 |
| Molecular Formula | C7H18N4 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | 3-amino-1,1-dimethyl-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(/NN)N(C)C |
| InChI | InChI=1S/C7H18N4/c1-6(2)5-9-7(10-8)11(3)4/h6H,5,8H2,1-4H3,(H,9,10) |
| InChIKey | LALMZWHFXNRUBI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|