C10H22N4O — CID 62363808
N,N-dimethyl-2-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide (PubChem CID 62363808) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N,N-dimethyl-2-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 62363808 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | N,N-dimethyl-2-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide |
| SMILES | CC(C)C/N=C(\N)NC(C)C(=O)N(C)C |
| InChI | InChI=1S/C10H22N4O/c1-7(2)6-12-10(11)13-8(3)9(15)14(4)5/h7-8H,6H2,1-5H3,(H3,11,12,13) |
| InChIKey | CIKWHENOXRDNOQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|