C7H15N3O2 — CID 59006567
(2R)-N,N-dimethyl-2-(methylcarbamoylamino)propanamide (PubChem CID 59006567) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-(methylcarbamoylamino)propanamide.
| Compound Name | (2R)-N,N-dimethyl-2-(methylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 59006567 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2R)-N,N-dimethyl-2-(methylcarbamoylamino)propanamide |
| SMILES | CNC(=O)N[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C7H15N3O2/c1-5(6(11)10(3)4)9-7(12)8-2/h5H,1-4H3,(H2,8,9,12)/t5-/m1/s1 |
| InChIKey | CCMNOQMFBXPXHO-RXMQYKEDSA-N |
| XLogP | -0.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |