C12H18N4O2 — CID 54955307
2-[(4-aminophenyl)carbamoylamino]-N,N-dimethylpropanamide (PubChem CID 54955307) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-[(4-aminophenyl)carbamoylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(4-aminophenyl)carbamoylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 54955307 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[(4-aminophenyl)carbamoylamino]-N,N-dimethylpropanamide |
| SMILES | CC(NC(=O)Nc1ccc(N)cc1)C(=O)N(C)C |
| InChI | InChI=1S/C12H18N4O2/c1-8(11(17)16(2)3)14-12(18)15-10-6-4-9(13)5-7-10/h4-8H,13H2,1-3H3,(H2,14,15,18) |
| InChIKey | FPRWWASGJZHIAH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|