C14H29N3O2 — CID 97027546
(2R)-N,N-dimethyl-2-[[(2S)-octan-2-yl]carbamoylamino]propanamide (PubChem CID 97027546) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-[[(2S)-octan-2-yl]carbamoylamino]propanamide.
| Compound Name | (2R)-N,N-dimethyl-2-[[(2S)-octan-2-yl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 97027546 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (2R)-N,N-dimethyl-2-[[(2S)-octan-2-yl]carbamoylamino]propanamide |
| SMILES | CCCCCC[C@H](C)NC(=O)N[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C14H29N3O2/c1-6-7-8-9-10-11(2)15-14(19)16-12(3)13(18)17(4)5/h11-12H,6-10H2,1-5H3,(H2,15,16,19)/t11-,12+/m0/s1 |
| InChIKey | FFQJVAAFOUCKMW-NWDGAFQWSA-N |
| XLogP | 2.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|