C17H36N2O — CID 43675030
N,N,4-trimethyl-2-(nonan-2-ylamino)pentanamide (PubChem CID 43675030) has the molecular formula C17H36N2O and a molecular weight of 284.49 g/mol. Its IUPAC name is N,N,4-trimethyl-2-(nonan-2-ylamino)pentanamide.
| Compound Name | N,N,4-trimethyl-2-(nonan-2-ylamino)pentanamide |
|---|---|
| PubChem CID | 43675030 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | N,N,4-trimethyl-2-(nonan-2-ylamino)pentanamide |
| SMILES | CCCCCCCC(C)NC(CC(C)C)C(=O)N(C)C |
| InChI | InChI=1S/C17H36N2O/c1-7-8-9-10-11-12-15(4)18-16(13-14(2)3)17(20)19(5)6/h14-16,18H,7-13H2,1-6H3 |
| InChIKey | TVCBGQDHJPBAPN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|