C14H30N2O — CID 43779357
N,N,4-trimethyl-2-(2-methylpentan-3-ylamino)pentanamide (PubChem CID 43779357) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N,N,4-trimethyl-2-(2-methylpentan-3-ylamino)pentanamide.
| Compound Name | N,N,4-trimethyl-2-(2-methylpentan-3-ylamino)pentanamide |
|---|---|
| PubChem CID | 43779357 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N,N,4-trimethyl-2-(2-methylpentan-3-ylamino)pentanamide |
| SMILES | CCC(NC(CC(C)C)C(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C14H30N2O/c1-8-12(11(4)5)15-13(9-10(2)3)14(17)16(6)7/h10-13,15H,8-9H2,1-7H3 |
| InChIKey | DFSRNVSGKLZLQL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |