C13H25BrN2O2 — CID 107908629
2-(5-bromopentanoylamino)-N,N,4-trimethylpentanamide (PubChem CID 107908629) has the molecular formula C13H25BrN2O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-(5-bromopentanoylamino)-N,N,4-trimethylpentanamide.
| Compound Name | 2-(5-bromopentanoylamino)-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 107908629 |
| Molecular Formula | C13H25BrN2O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(5-bromopentanoylamino)-N,N,4-trimethylpentanamide |
| SMILES | CC(C)CC(NC(=O)CCCCBr)C(=O)N(C)C |
| InChI | InChI=1S/C13H25BrN2O2/c1-10(2)9-11(13(18)16(3)4)15-12(17)7-5-6-8-14/h10-11H,5-9H2,1-4H3,(H,15,17) |
| InChIKey | DIAZOGIUMYSPKY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|