2-(2-methylpentan-3-ylamino)pentanoic acid

C11H23NO2 — CID 65055510

IUPAC2-(2-methylpentan-3-ylamino)pentanoic acid
SMILESCCCC(NC(CC)C(C)C)C(=O)O
InChIInChI=1S/C11H23NO2/c1-5-7-10(11(13)14)12-9(6-2)8(3)4/h8-10,12H,5-7H2,1-4H3,(H,13,14)
InChIKeyNZXIMTFCRQTATK-UHFFFAOYSA-N
MW201.31 g/mol
LogP2.26
Rot. Bonds7

About 2-(2-methylpentan-3-ylamino)pentanoic acid

2-(2-methylpentan-3-ylamino)pentanoic acid (PubChem CID 65055510) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(2-methylpentan-3-ylamino)pentanoic acid.

Molecular Properties

Compound Name2-(2-methylpentan-3-ylamino)pentanoic acid
PubChem CID65055510
Molecular FormulaC11H23NO2
Molecular Weight201.31 g/mol
Exact Mass201.17
IUPAC Name2-(2-methylpentan-3-ylamino)pentanoic acid
SMILESCCCC(NC(CC)C(C)C)C(=O)O
InChIInChI=1S/C11H23NO2/c1-5-7-10(11(13)14)12-9(6-2)8(3)4/h8-10,12H,5-7H2,1-4H3,(H,13,14)
InChIKeyNZXIMTFCRQTATK-UHFFFAOYSA-N
XLogP2.26
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.31
LogP ≤ 52.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2-methylpentan-3-ylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-(2-methylpentan-3-ylcarbamoylamino)pentanoic acid
CID 107566471
(2R)-2-(oxidoamino)pentanoic acid
CID 141472977
2-(2-methylpentan-3-ylcarbamoylamino)hexanoic acid
CID 54954839
(2R)-2-(methylamino)pentanoic acid
CID 15677248
CID 159174397
CID 159174397
2-(pentan-2-ylamino)hexanoic acid
CID 103231809
2-(1-carboxybutylamino)-3-hydroxybutanedioic acid
CID 144600064
(2R)-2-(2,3-dimethylbutanoylamino)pentanoic acid
CID 107563339
2-(4-methoxybutan-2-ylamino)pentanoic acid
CID 65055472
(2S)-2-(iodoamino)pentanoic acid
CID 175707899
butane;2-(hydroxyamino)pentanoic acid
CID 90041467
2-(1-carboxypentylamino)hexanoic acid
CID 22643835

Frequently Asked Questions

What is the IUPAC name of 2-(2-methylpentan-3-ylamino)pentanoic acid?
The IUPAC name of 2-(2-methylpentan-3-ylamino)pentanoic acid (CID 65055510) is 2-(2-methylpentan-3-ylamino)pentanoic acid.
What is the SMILES notation for 2-(2-methylpentan-3-ylamino)pentanoic acid?
The canonical SMILES for 2-(2-methylpentan-3-ylamino)pentanoic acid is CCCC(NC(CC)C(C)C)C(=O)O.
What is the InChIKey of 2-(2-methylpentan-3-ylamino)pentanoic acid?
The InChIKey is NZXIMTFCRQTATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-7-10(11(13)14)12-9(6-2)8(3)4/h8-10,12H,5-7H2,1-4H3,(H,13,14).
What are the key properties of 2-(2-methylpentan-3-ylamino)pentanoic acid?
2-(2-methylpentan-3-ylamino)pentanoic acid has a molecular weight of 201.31 g/mol, XLogP of 2.26, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpentan-3-ylamino)pentanoic acid is sourced from PubChem (CID 65055510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).