C13H28N2O — CID 115711305
N,N,3-trimethyl-2-(2-methylpentan-3-ylamino)butanamide (PubChem CID 115711305) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N,N,3-trimethyl-2-(2-methylpentan-3-ylamino)butanamide.
| Compound Name | N,N,3-trimethyl-2-(2-methylpentan-3-ylamino)butanamide |
|---|---|
| PubChem CID | 115711305 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N,N,3-trimethyl-2-(2-methylpentan-3-ylamino)butanamide |
| SMILES | CCC(NC(C(=O)N(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C13H28N2O/c1-8-11(9(2)3)14-12(10(4)5)13(16)15(6)7/h9-12,14H,8H2,1-7H3 |
| InChIKey | BGLREFKARVOWSV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |