C12H26N2O2 — CID 115711311
2-(1-methoxybutan-2-ylamino)-N,N,3-trimethylbutanamide (PubChem CID 115711311) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(1-methoxybutan-2-ylamino)-N,N,3-trimethylbutanamide.
| Compound Name | 2-(1-methoxybutan-2-ylamino)-N,N,3-trimethylbutanamide |
|---|---|
| PubChem CID | 115711311 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-(1-methoxybutan-2-ylamino)-N,N,3-trimethylbutanamide |
| SMILES | CCC(COC)NC(C(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-7-10(8-16-6)13-11(9(2)3)12(15)14(4)5/h9-11,13H,7-8H2,1-6H3 |
| InChIKey | IPYCSDRMQRWQFP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |