C7H18N2O — CID 83007335
2-(1-methoxybutan-2-yl)-1,1-dimethylhydrazine (PubChem CID 83007335) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is 2-(1-methoxybutan-2-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(1-methoxybutan-2-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83007335 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 2-(1-methoxybutan-2-yl)-1,1-dimethylhydrazine |
| SMILES | CCC(COC)NN(C)C |
| InChI | InChI=1S/C7H18N2O/c1-5-7(6-10-4)8-9(2)3/h7-8H,5-6H2,1-4H3 |
| InChIKey | OLRZTLSLXILJMN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|