C9H20N2O2 — CID 61464462
2-(2-hydroxybutylamino)-N,N-dimethylpropanamide (PubChem CID 61464462) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(2-hydroxybutylamino)-N,N-dimethylpropanamide.
| Compound Name | 2-(2-hydroxybutylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 61464462 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-(2-hydroxybutylamino)-N,N-dimethylpropanamide |
| SMILES | CCC(O)CNC(C)C(=O)N(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-5-8(12)6-10-7(2)9(13)11(3)4/h7-8,10,12H,5-6H2,1-4H3 |
| InChIKey | HGUSIULSYHWIJU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |