C7H16N2O2 — CID 86625703
(2S)-2-(2-hydroxyethylamino)-N,N-dimethylpropanamide (PubChem CID 86625703) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (2S)-2-(2-hydroxyethylamino)-N,N-dimethylpropanamide.
| Compound Name | (2S)-2-(2-hydroxyethylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 86625703 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | (2S)-2-(2-hydroxyethylamino)-N,N-dimethylpropanamide |
| SMILES | C[C@H](NCCO)C(=O)N(C)C |
| InChI | InChI=1S/C7H16N2O2/c1-6(8-4-5-10)7(11)9(2)3/h6,8,10H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | LCXOVVROLOKSKH-LURJTMIESA-N |
| XLogP | -0.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |