C8H18N2O3S — CID 60919155
N,N-dimethyl-2-(2-methylsulfonylethylamino)propanamide (PubChem CID 60919155) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-methylsulfonylethylamino)propanamide.
| Compound Name | N,N-dimethyl-2-(2-methylsulfonylethylamino)propanamide |
|---|---|
| PubChem CID | 60919155 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N,N-dimethyl-2-(2-methylsulfonylethylamino)propanamide |
| SMILES | CC(NCCS(C)(=O)=O)C(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O3S/c1-7(8(11)10(2)3)9-5-6-14(4,12)13/h7,9H,5-6H2,1-4H3 |
| InChIKey | MFHRGWNUSLPDFP-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |