C8H18N4O2 — CID 83120649
2-[2-(carbamoylamino)ethylamino]-N,N-dimethylpropanamide (PubChem CID 83120649) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)ethylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[2-(carbamoylamino)ethylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 83120649 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[2-(carbamoylamino)ethylamino]-N,N-dimethylpropanamide |
| SMILES | CC(NCCNC(N)=O)C(=O)N(C)C |
| InChI | InChI=1S/C8H18N4O2/c1-6(7(13)12(2)3)10-4-5-11-8(9)14/h6,10H,4-5H2,1-3H3,(H3,9,11,14) |
| InChIKey | CUKXHZFDCWNTRZ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|