C12H26N4O2 — CID 83120791
2-[2-(dimethylcarbamoylamino)ethylamino]-N,N-diethylpropanamide (PubChem CID 83120791) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[2-(dimethylcarbamoylamino)ethylamino]-N,N-diethylpropanamide.
| Compound Name | 2-[2-(dimethylcarbamoylamino)ethylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 83120791 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-[2-(dimethylcarbamoylamino)ethylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NCCNC(=O)N(C)C |
| InChI | InChI=1S/C12H26N4O2/c1-6-16(7-2)11(17)10(3)13-8-9-14-12(18)15(4)5/h10,13H,6-9H2,1-5H3,(H,14,18) |
| InChIKey | ZTQXSFJIOUBELQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|