C10H21FN2O — CID 115731800
N,N-diethyl-2-(3-fluoropropylamino)propanamide (PubChem CID 115731800) has the molecular formula C10H21FN2O and a molecular weight of 204.29 g/mol. Its IUPAC name is N,N-diethyl-2-(3-fluoropropylamino)propanamide.
| Compound Name | N,N-diethyl-2-(3-fluoropropylamino)propanamide |
|---|---|
| PubChem CID | 115731800 |
| Molecular Formula | C10H21FN2O |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N,N-diethyl-2-(3-fluoropropylamino)propanamide |
| SMILES | CCN(CC)C(=O)C(C)NCCCF |
| InChI | InChI=1S/C10H21FN2O/c1-4-13(5-2)10(14)9(3)12-8-6-7-11/h9,12H,4-8H2,1-3H3 |
| InChIKey | CTKRCLMAOIALBF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|