C8H18N2O2 — CID 60721258
N,N-diethyl-2-(methoxyamino)propanamide (PubChem CID 60721258) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is N,N-diethyl-2-(methoxyamino)propanamide.
| Compound Name | N,N-diethyl-2-(methoxyamino)propanamide |
|---|---|
| PubChem CID | 60721258 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | N,N-diethyl-2-(methoxyamino)propanamide |
| SMILES | CCN(CC)C(=O)C(C)NOC |
| InChI | InChI=1S/C8H18N2O2/c1-5-10(6-2)8(11)7(3)9-12-4/h7,9H,5-6H2,1-4H3 |
| InChIKey | STFICVDGSYTBKU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|