C11H25N3O3 — CID 87889467
2-amino-N,N-diethylpropanamide;methyl 2-aminopropanoate (PubChem CID 87889467) has the molecular formula C11H25N3O3 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-amino-N,N-diethylpropanamide;methyl 2-aminopropanoate.
| Compound Name | 2-amino-N,N-diethylpropanamide;methyl 2-aminopropanoate |
|---|---|
| PubChem CID | 87889467 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-amino-N,N-diethylpropanamide;methyl 2-aminopropanoate |
| SMILES | CCN(CC)C(=O)C(C)N.COC(=O)C(C)N |
| InChI | InChI=1S/C7H16N2O.C4H9NO2/c1-4-9(5-2)7(10)6(3)8;1-3(5)4(6)7-2/h6H,4-5,8H2,1-3H3;3H,5H2,1-2H3 |
| InChIKey | DZSVUVGFKJBERC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |