C10H23N3O — CID 103388840
2-(1-aminopropan-2-ylamino)-N,N-diethylpropanamide (PubChem CID 103388840) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(1-aminopropan-2-ylamino)-N,N-diethylpropanamide.
| Compound Name | 2-(1-aminopropan-2-ylamino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 103388840 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 2-(1-aminopropan-2-ylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC(C)CN |
| InChI | InChI=1S/C10H23N3O/c1-5-13(6-2)10(14)9(4)12-8(3)7-11/h8-9,12H,5-7,11H2,1-4H3 |
| InChIKey | GBJABGFRHYYOAP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |