C13H25F3N2O — CID 116534471
N,N-diethyl-2-(6,6,6-trifluorohexan-2-ylamino)propanamide (PubChem CID 116534471) has the molecular formula C13H25F3N2O and a molecular weight of 282.35 g/mol. Its IUPAC name is N,N-diethyl-2-(6,6,6-trifluorohexan-2-ylamino)propanamide.
| Compound Name | N,N-diethyl-2-(6,6,6-trifluorohexan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 116534471 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N,N-diethyl-2-(6,6,6-trifluorohexan-2-ylamino)propanamide |
| SMILES | CCN(CC)C(=O)C(C)NC(C)CCCC(F)(F)F |
| InChI | InChI=1S/C13H25F3N2O/c1-5-18(6-2)12(19)11(4)17-10(3)8-7-9-13(14,15)16/h10-11,17H,5-9H2,1-4H3 |
| InChIKey | QILYDUOAXGBYFM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |