C13H26F3N — CID 116534085
5-methyl-N-(6,6,6-trifluorohexan-2-yl)hexan-2-amine (PubChem CID 116534085) has the molecular formula C13H26F3N and a molecular weight of 253.35 g/mol. Its IUPAC name is 5-methyl-N-(6,6,6-trifluorohexan-2-yl)hexan-2-amine.
| Compound Name | 5-methyl-N-(6,6,6-trifluorohexan-2-yl)hexan-2-amine |
|---|---|
| PubChem CID | 116534085 |
| Molecular Formula | C13H26F3N |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 5-methyl-N-(6,6,6-trifluorohexan-2-yl)hexan-2-amine |
| SMILES | CC(C)CCC(C)NC(C)CCCC(F)(F)F |
| InChI | InChI=1S/C13H26F3N/c1-10(2)7-8-12(4)17-11(3)6-5-9-13(14,15)16/h10-12,17H,5-9H2,1-4H3 |
| InChIKey | ZNDWBRSYCMOXEM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |