C9H16F3N5 — CID 116534707
6,6,6-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]hexan-2-amine (PubChem CID 116534707) has the molecular formula C9H16F3N5 and a molecular weight of 251.26 g/mol. Its IUPAC name is 6,6,6-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]hexan-2-amine.
| Compound Name | 6,6,6-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]hexan-2-amine |
|---|---|
| PubChem CID | 116534707 |
| Molecular Formula | C9H16F3N5 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 6,6,6-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]hexan-2-amine |
| SMILES | CC(CCCC(F)(F)F)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C9H16F3N5/c1-6(4-3-5-9(10,11)12)13-7(2)8-14-16-17-15-8/h6-7,13H,3-5H2,1-2H3,(H,14,15,16,17) |
| InChIKey | ANONXCLCKYGUND-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |