C14H28N6O3 — CID 103389670
tert-butyl N-[5-methoxy-4-[1-(2H-tetrazol-5-yl)ethylamino]pentyl]carbamate (PubChem CID 103389670) has the molecular formula C14H28N6O3 and a molecular weight of 328.42 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-[1-(2H-tetrazol-5-yl)ethylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-[1-(2H-tetrazol-5-yl)ethylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 103389670 |
| Molecular Formula | C14H28N6O3 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-[1-(2H-tetrazol-5-yl)ethylamino]pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C14H28N6O3/c1-10(12-17-19-20-18-12)16-11(9-22-5)7-6-8-15-13(21)23-14(2,3)4/h10-11,16H,6-9H2,1-5H3,(H,15,21)(H,17,18,19,20) |
| InChIKey | HQWAXXFKAMKKAH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|