C16H34N2O4S — CID 103391054
tert-butyl N-[5-methoxy-4-(4-methylsulfinylbutan-2-ylamino)pentyl]carbamate (PubChem CID 103391054) has the molecular formula C16H34N2O4S and a molecular weight of 350.53 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-(4-methylsulfinylbutan-2-ylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-(4-methylsulfinylbutan-2-ylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 103391054 |
| Molecular Formula | C16H34N2O4S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-(4-methylsulfinylbutan-2-ylamino)pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NC(C)CCS(C)=O |
| InChI | InChI=1S/C16H34N2O4S/c1-13(9-11-23(6)20)18-14(12-21-5)8-7-10-17-15(19)22-16(2,3)4/h13-14,18H,7-12H2,1-6H3,(H,17,19) |
| InChIKey | IQXJNASPNWGDDQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|