C16H34N2O4 — CID 103390318
tert-butyl N-[4-[(1-hydroxy-3-methylbutan-2-yl)amino]-5-methoxypentyl]carbamate (PubChem CID 103390318) has the molecular formula C16H34N2O4 and a molecular weight of 318.46 g/mol. Its IUPAC name is tert-butyl N-[4-[(1-hydroxy-3-methylbutan-2-yl)amino]-5-methoxypentyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1-hydroxy-3-methylbutan-2-yl)amino]-5-methoxypentyl]carbamate |
|---|---|
| PubChem CID | 103390318 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | tert-butyl N-[4-[(1-hydroxy-3-methylbutan-2-yl)amino]-5-methoxypentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NC(CO)C(C)C |
| InChI | InChI=1S/C16H34N2O4/c1-12(2)14(10-19)18-13(11-21-6)8-7-9-17-15(20)22-16(3,4)5/h12-14,18-19H,7-11H2,1-6H3,(H,17,20) |
| InChIKey | ZEEMTZNSXIJHFX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|