C10H21NO3S — CID 176958656
tert-butyl N-(4-methylsulfinylbutyl)carbamate (PubChem CID 176958656) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is tert-butyl N-(4-methylsulfinylbutyl)carbamate.
| Compound Name | tert-butyl N-(4-methylsulfinylbutyl)carbamate |
|---|---|
| PubChem CID | 176958656 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | tert-butyl N-(4-methylsulfinylbutyl)carbamate |
| SMILES | CS(=O)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO3S/c1-10(2,3)14-9(12)11-7-5-6-8-15(4)13/h5-8H2,1-4H3,(H,11,12) |
| InChIKey | FAHBANWWXGNWMW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|