C12H26N2O3S — CID 103391026
tert-butyl N-[2-(3-methylsulfinylpropylamino)propyl]carbamate (PubChem CID 103391026) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is tert-butyl N-[2-(3-methylsulfinylpropylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-methylsulfinylpropylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103391026 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | tert-butyl N-[2-(3-methylsulfinylpropylamino)propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NCCCS(C)=O |
| InChI | InChI=1S/C12H26N2O3S/c1-10(13-7-6-8-18(5)16)9-14-11(15)17-12(2,3)4/h10,13H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | MHQOFPLSCQYENR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|