C8H16NO4S- — CID 134183090
3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate (PubChem CID 134183090) has the molecular formula C8H16NO4S- and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate |
|---|---|
| PubChem CID | 134183090 |
| Molecular Formula | C8H16NO4S- |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate |
| SMILES | CC(C)(C)OC(=O)NCCCS(=O)[O-] |
| InChI | InChI=1S/C8H17NO4S/c1-8(2,3)13-7(10)9-5-4-6-14(11)12/h4-6H2,1-3H3,(H,9,10)(H,11,12)/p-1 |
| InChIKey | VRJLHUDPDDNBHG-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|